C20H19ClFNO5S — CID 88512156
propan-2-yl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzoyl]sulfanylacetate (PubChem CID 88512156) has the molecular formula C20H19ClFNO5S and a molecular weight of 439.89 g/mol. Its IUPAC name is propan-2-yl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzoyl]sulfanylacetate.
| Compound Name | propan-2-yl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzoyl]sulfanylacetate |
|---|---|
| PubChem CID | 88512156 |
| Molecular Formula | C20H19ClFNO5S |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | propan-2-yl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzoyl]sulfanylacetate |
| SMILES | CC(C)OC(=O)CSC(=O)c1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C20H19ClFNO5S/c1-10(2)28-17(24)9-29-20(27)13-7-16(15(22)8-14(13)21)23-18(25)11-5-3-4-6-12(11)19(23)26/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | IFZLQJOKRHYHHD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|