C18H23N5O2 — CID 88512219
2-butyl-1-cyano-3-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine (PubChem CID 88512219) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-butyl-1-cyano-3-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine.
| Compound Name | 2-butyl-1-cyano-3-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine |
|---|---|
| PubChem CID | 88512219 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-butyl-1-cyano-3-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine |
| SMILES | CCCC/N=C(\NC#N)N[C@@H]1c2cc(C#N)ccc2OC(C)(C)[C@H]1O |
| InChI | InChI=1S/C18H23N5O2/c1-4-5-8-21-17(22-11-20)23-15-13-9-12(10-19)6-7-14(13)25-18(2,3)16(15)24/h6-7,9,15-16,24H,4-5,8H2,1-3H3,(H2,21,22,23)/t15-,16+/m1/s1 |
| InChIKey | QTYXDZJPINECHD-CVEARBPZSA-N |
| XLogP | 1.95 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|