C19H23N5 — CID 8851244
1-[4-[(dimethylamino)methyl]phenyl]-N-[(2-phenyltriazol-4-yl)methyl]methanamine (PubChem CID 8851244) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[4-[(dimethylamino)methyl]phenyl]-N-[(2-phenyltriazol-4-yl)methyl]methanamine.
| Compound Name | 1-[4-[(dimethylamino)methyl]phenyl]-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 8851244 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-[4-[(dimethylamino)methyl]phenyl]-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
| SMILES | CN(C)Cc1ccc(CNCc2cnn(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H23N5/c1-23(2)15-17-10-8-16(9-11-17)12-20-13-18-14-21-24(22-18)19-6-4-3-5-7-19/h3-11,14,20H,12-13,15H2,1-2H3 |
| InChIKey | FNPQROHFDGOBPL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |