About 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione
2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione (PubChem CID 88512971) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione.
Molecular Properties
| Compound Name | 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione |
| PubChem CID | 88512971 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione |
| SMILES | C=CCC1NC(=S)C=CN1CC=C |
| InChI | InChI=1S/C10H14N2S/c1-3-5-9-11-10(13)6-8-12(9)7-4-2/h3-4,6,8-9H,1-2,5,7H2,(H,11,13) |
| InChIKey | HBYNDGHESXIXRZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione?
The IUPAC name of 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione (CID 88512971) is 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione.
What is the SMILES notation for 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione?
The canonical SMILES for 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione is C=CCC1NC(=S)C=CN1CC=C.
What is the InChIKey of 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione?
The InChIKey is HBYNDGHESXIXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-3-5-9-11-10(13)6-8-12(9)7-4-2/h3-4,6,8-9H,1-2,5,7H2,(H,11,13).
What are the key properties of 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione?
2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione has a molecular weight of 194.30 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(prop-2-enyl)-1,2-dihydropyrimidine-6-thione is sourced from PubChem (CID 88512971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).