About butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate
butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate (PubChem CID 88513032) has the molecular formula C30H52O7
and a molecular weight of 524.74 g/mol. Its IUPAC name is butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate |
| PubChem CID | 88513032 |
| Molecular Formula | C30H52O7 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C(=O)OCCCCCCCCCCCC)C1CO1.C=C(C)C(=O)OCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C17H30O3.C7H12O2.C6H10O2/c1-3-4-5-6-7-8-9-10-11-12-13-19-17(18)15(2)16-14-20-16;1-3-5-6-9-7(8)4-2;1-4-8-6(7)5(2)3/h16H,2-14H2,1H3;4H,2-3,5-6H2,1H3;2,4H2,1,3H3 |
| InChIKey | JYNDWLARBHIKFD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate?
The IUPAC name of butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate (CID 88513032) is butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate?
The canonical SMILES for butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate is C=C(C(=O)OCCCCCCCCCCCC)C1CO1.C=C(C)C(=O)OCC.C=CC(=O)OCCCC.
What is the InChIKey of butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate?
The InChIKey is JYNDWLARBHIKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3.C7H12O2.C6H10O2/c1-3-4-5-6-7-8-9-10-11-12-13-19-17(18)15(2)16-14-20-16;1-3-5-6-9-7(8)4-2;1-4-8-6(7)5(2)3/h16H,2-14H2,1H3;4H,2-3,5-6H2,1H3;2,4H2,1,3H3.
What are the key properties of butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate?
butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate has a molecular weight of 524.74 g/mol, XLogP of 7.05, 19 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl prop-2-enoate;dodecyl 2-(oxiran-2-yl)prop-2-enoate;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 88513032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).