About 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine
7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 88513124) has the molecular formula C12H8FN2O2S-
and a molecular weight of 263.27 g/mol. Its IUPAC name is 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine |
| PubChem CID | 88513124 |
| Molecular Formula | C12H8FN2O2S- |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | C#CCC1c2cc(N=C=S)c(F)cc2OCN1[O-] |
| InChI | InChI=1S/C12H8FN2O2S/c1-2-3-11-8-4-10(14-6-18)9(13)5-12(8)17-7-15(11)16/h1,4-5,11H,3,7H2/q-1 |
| InChIKey | RSEKUQWMSDXSKY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine?
The IUPAC name of 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine (CID 88513124) is 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine.
What is the SMILES notation for 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine?
The canonical SMILES for 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine is C#CCC1c2cc(N=C=S)c(F)cc2OCN1[O-].
What is the InChIKey of 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine?
The InChIKey is RSEKUQWMSDXSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN2O2S/c1-2-3-11-8-4-10(14-6-18)9(13)5-12(8)17-7-15(11)16/h1,4-5,11H,3,7H2/q-1.
What are the key properties of 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine?
7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine has a molecular weight of 263.27 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-6-isothiocyanato-3-oxido-4-prop-2-ynyl-2,4-dihydro-1,3-benzoxazine is sourced from PubChem (CID 88513124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).