C9H5F9O4 — CID 88513511
prop-2-enyl 2,3,3,3-tetrafluoro-2-(1,1,3,3,3-pentafluoro-2-oxopropoxy)propanoate (PubChem CID 88513511) has the molecular formula C9H5F9O4 and a molecular weight of 348.12 g/mol. Its IUPAC name is prop-2-enyl 2,3,3,3-tetrafluoro-2-(1,1,3,3,3-pentafluoro-2-oxopropoxy)propanoate.
| Compound Name | prop-2-enyl 2,3,3,3-tetrafluoro-2-(1,1,3,3,3-pentafluoro-2-oxopropoxy)propanoate |
|---|---|
| PubChem CID | 88513511 |
| Molecular Formula | C9H5F9O4 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | prop-2-enyl 2,3,3,3-tetrafluoro-2-(1,1,3,3,3-pentafluoro-2-oxopropoxy)propanoate |
| SMILES | C=CCOC(=O)C(F)(OC(F)(F)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F9O4/c1-2-3-21-5(20)6(10,9(16,17)18)22-8(14,15)4(19)7(11,12)13/h2H,1,3H2 |
| InChIKey | JVGRVHAZUMJZIA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|