C12H22N2O4Pt — CID 88513685
2-(1,4-diaminohexyl)cyclobutane-1,1-dicarboxylic acid;platinum (PubChem CID 88513685) has the molecular formula C12H22N2O4Pt and a molecular weight of 453.40 g/mol. Its IUPAC name is 2-(1,4-diaminohexyl)cyclobutane-1,1-dicarboxylic acid;platinum.
| Compound Name | 2-(1,4-diaminohexyl)cyclobutane-1,1-dicarboxylic acid;platinum |
|---|---|
| PubChem CID | 88513685 |
| Molecular Formula | C12H22N2O4Pt |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-(1,4-diaminohexyl)cyclobutane-1,1-dicarboxylic acid;platinum |
| SMILES | CCC(N)CCC(N)C1CCC1(C(=O)O)C(=O)O.[Pt] |
| InChI | InChI=1S/C12H22N2O4.Pt/c1-2-7(13)3-4-9(14)8-5-6-12(8,10(15)16)11(17)18;/h7-9H,2-6,13-14H2,1H3,(H,15,16)(H,17,18); |
| InChIKey | MFDVIIBRYXSTBC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|