C17H12F3NO3 — CID 88513745
(E)-2,3-diphenyl-3-[(2,2,2-trifluoroacetyl)amino]prop-2-enoic acid (PubChem CID 88513745) has the molecular formula C17H12F3NO3 and a molecular weight of 335.28 g/mol. Its IUPAC name is (E)-2,3-diphenyl-3-[(2,2,2-trifluoroacetyl)amino]prop-2-enoic acid.
| Compound Name | (E)-2,3-diphenyl-3-[(2,2,2-trifluoroacetyl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 88513745 |
| Molecular Formula | C17H12F3NO3 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (E)-2,3-diphenyl-3-[(2,2,2-trifluoroacetyl)amino]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C(/NC(=O)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H12F3NO3/c18-17(19,20)16(24)21-14(12-9-5-2-6-10-12)13(15(22)23)11-7-3-1-4-8-11/h1-10H,(H,21,24)(H,22,23)/b14-13+ |
| InChIKey | TVRTUQHHIRNZSF-BUHFOSPRSA-N |
| XLogP | 3.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|