About 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene
1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 88514840) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 88514840 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC(C)C12C=CC=CC1(C(C)C)O2 |
| InChI | InChI=1S/C12H18O/c1-9(2)11-7-5-6-8-12(11,13-11)10(3)4/h5-10H,1-4H3 |
| InChIKey | KGSZJJXPYRHHSY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene (CID 88514840) is 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene is CC(C)C12C=CC=CC1(C(C)C)O2.
What is the InChIKey of 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is KGSZJJXPYRHHSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-9(2)11-7-5-6-8-12(11,13-11)10(3)4/h5-10H,1-4H3.
What are the key properties of 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene?
1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 178.27 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-di(propan-2-yl)-7-oxabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 88514840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).