About 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane
2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane (PubChem CID 88514846) has the molecular formula C26H21BF6N2
and a molecular weight of 486.27 g/mol. Its IUPAC name is 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane.
Molecular Properties
| Compound Name | 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane |
| PubChem CID | 88514846 |
| Molecular Formula | C26H21BF6N2 |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane |
| SMILES | C=CB(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.c1ccc(Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C16H11BF6.C10H10N2/c1-2-17(13-7-3-5-11(9-13)15(18,19)20)14-8-4-6-12(10-14)16(21,22)23;1-2-4-9(5-3-1)8-10-11-6-7-12-10/h2-10H,1H2;1-7H,8H2,(H,11,12) |
| InChIKey | FBTIXLILKAJBQF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane?
The IUPAC name of 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane (CID 88514846) is 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane.
What is the SMILES notation for 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane?
The canonical SMILES for 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane is C=CB(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.c1ccc(Cc2ncc[nH]2)cc1.
What is the InChIKey of 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane?
The InChIKey is FBTIXLILKAJBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BF6.C10H10N2/c1-2-17(13-7-3-5-11(9-13)15(18,19)20)14-8-4-6-12(10-14)16(21,22)23;1-2-4-9(5-3-1)8-10-11-6-7-12-10/h2-10H,1H2;1-7H,8H2,(H,11,12).
What are the key properties of 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane?
2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane has a molecular weight of 486.27 g/mol, XLogP of 6.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-imidazole;ethenyl-bis[3-(trifluoromethyl)phenyl]borane is sourced from PubChem (CID 88514846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).