About (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate
(1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate (PubChem CID 88515486) has the molecular formula C34H29F3O2
and a molecular weight of 526.60 g/mol. Its IUPAC name is (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate.
Molecular Properties
| Compound Name | (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate |
| PubChem CID | 88515486 |
| Molecular Formula | C34H29F3O2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)OC(c3c4ccccc4cc4ccccc34)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H29F3O2/c1-2-3-4-9-23-14-16-24(17-15-23)25-18-20-26(21-19-25)33(38)39-32(34(35,36)37)31-29-12-7-5-10-27(29)22-28-11-6-8-13-30(28)31/h5-8,10-22,32H,2-4,9H2,1H3 |
| InChIKey | MVUUBEPRCBPGRK-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate?
The IUPAC name of (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate (CID 88515486) is (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate.
What is the SMILES notation for (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate?
The canonical SMILES for (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate is CCCCCc1ccc(-c2ccc(C(=O)OC(c3c4ccccc4cc4ccccc34)C(F)(F)F)cc2)cc1.
What is the InChIKey of (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate?
The InChIKey is MVUUBEPRCBPGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H29F3O2/c1-2-3-4-9-23-14-16-24(17-15-23)25-18-20-26(21-19-25)33(38)39-32(34(35,36)37)31-29-12-7-5-10-27(29)22-28-11-6-8-13-30(28)31/h5-8,10-22,32H,2-4,9H2,1H3.
What are the key properties of (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate?
(1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate has a molecular weight of 526.60 g/mol, XLogP of 9.85, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-anthracen-9-yl-2,2,2-trifluoroethyl) 4-(4-pentylphenyl)benzoate is sourced from PubChem (CID 88515486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).