C26H48O2S2+2 — CID 88515792
[4-(dimethylsulfoniomethyl)-2,5-diheptoxyphenyl]methyl-dimethylsulfanium (PubChem CID 88515792) has the molecular formula C26H48O2S2+2 and a molecular weight of 456.80 g/mol. Its IUPAC name is [4-(dimethylsulfoniomethyl)-2,5-diheptoxyphenyl]methyl-dimethylsulfanium.
| Compound Name | [4-(dimethylsulfoniomethyl)-2,5-diheptoxyphenyl]methyl-dimethylsulfanium |
|---|---|
| PubChem CID | 88515792 |
| Molecular Formula | C26H48O2S2+2 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | [4-(dimethylsulfoniomethyl)-2,5-diheptoxyphenyl]methyl-dimethylsulfanium |
| SMILES | CCCCCCCOc1cc(C[S+](C)C)c(OCCCCCCC)cc1C[S+](C)C |
| InChI | InChI=1S/C26H48O2S2/c1-7-9-11-13-15-17-27-25-19-24(22-30(5)6)26(20-23(25)21-29(3)4)28-18-16-14-12-10-8-2/h19-20H,7-18,21-22H2,1-6H3/q+2 |
| InChIKey | NEZWJDYIWXTHIW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|