About 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol
4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol (PubChem CID 88515963) has the molecular formula C13H15ClN2O7S2
and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol.
Molecular Properties
| Compound Name | 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol |
| PubChem CID | 88515963 |
| Molecular Formula | C13H15ClN2O7S2 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1ccc(O)c(N)c1.Nc1cc(Cl)c(S(=O)(=O)O)cc1O |
| InChI | InChI=1S/C7H9NO3S.C6H6ClNO4S/c1-12(10,11)5-2-3-7(9)6(8)4-5;7-3-1-4(8)5(9)2-6(3)13(10,11)12/h2-4,9H,8H2,1H3;1-2,9H,8H2,(H,10,11,12) |
| InChIKey | PSLWEARIHJFBCZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol?
The IUPAC name of 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol (CID 88515963) is 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol.
What is the SMILES notation for 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol?
The canonical SMILES for 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol is CS(=O)(=O)c1ccc(O)c(N)c1.Nc1cc(Cl)c(S(=O)(=O)O)cc1O.
What is the InChIKey of 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol?
The InChIKey is PSLWEARIHJFBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S.C6H6ClNO4S/c1-12(10,11)5-2-3-7(9)6(8)4-5;7-3-1-4(8)5(9)2-6(3)13(10,11)12/h2-4,9H,8H2,1H3;1-2,9H,8H2,(H,10,11,12).
What are the key properties of 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol?
4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol has a molecular weight of 410.86 g/mol, XLogP of 1.25, 2 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-chloro-5-hydroxybenzenesulfonic acid;2-amino-4-methylsulfonylphenol is sourced from PubChem (CID 88515963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).