About 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate
2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate (PubChem CID 88516259) has the molecular formula C48H92O4
and a molecular weight of 733.26 g/mol. Its IUPAC name is 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate |
| PubChem CID | 88516259 |
| Molecular Formula | C48H92O4 |
| Molecular Weight | 733.26 g/mol |
| Exact Mass | 732.70 |
| IUPAC Name | 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)C.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCCCC |
| InChI | InChI=1S/C26H50O2.C22H42O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26(27)28-25-23-21-10-8-6-4-2;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3/h14-15H,3-13,16-25H2,1-2H3;11-12,21H,4-10,13-20H2,1-3H3/b15-14-;12-11- |
| InChIKey | ZRHHZFOUWQTGPJ-BWQVBTMBSA-N |
| XLogP | 16.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 733.26 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate?
The IUPAC name of 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate (CID 88516259) is 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate.
What is the SMILES notation for 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate?
The canonical SMILES for 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)C.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCCCC.
What is the InChIKey of 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate?
The InChIKey is ZRHHZFOUWQTGPJ-BWQVBTMBSA-N. The full InChI is InChI=1S/C26H50O2.C22H42O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26(27)28-25-23-21-10-8-6-4-2;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3/h14-15H,3-13,16-25H2,1-2H3;11-12,21H,4-10,13-20H2,1-3H3/b15-14-;12-11-.
What are the key properties of 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate?
2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate has a molecular weight of 733.26 g/mol, XLogP of 16.15, 39 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (Z)-octadec-9-enoate;octyl (Z)-octadec-9-enoate is sourced from PubChem (CID 88516259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).