About 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid
2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid (PubChem CID 88516566) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid.
Molecular Properties
| Compound Name | 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid |
| PubChem CID | 88516566 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid |
| SMILES | CC(CC1CCCCC1C(=O)OO)CC(C)(C)C |
| InChI | InChI=1S/C15H28O3/c1-11(10-15(2,3)4)9-12-7-5-6-8-13(12)14(16)18-17/h11-13,17H,5-10H2,1-4H3 |
| InChIKey | BFPVTZYUSIHXJW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid?
The IUPAC name of 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid (CID 88516566) is 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid.
What is the SMILES notation for 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid?
The canonical SMILES for 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid is CC(CC1CCCCC1C(=O)OO)CC(C)(C)C.
What is the InChIKey of 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid?
The InChIKey is BFPVTZYUSIHXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-11(10-15(2,3)4)9-12-7-5-6-8-13(12)14(16)18-17/h11-13,17H,5-10H2,1-4H3.
What are the key properties of 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid?
2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid has a molecular weight of 256.39 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,4-trimethylpentyl)cyclohexane-1-carboperoxoic acid is sourced from PubChem (CID 88516566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).