C36H39F3O2 — CID 88516577
[(1S)-1-anthracen-9-yl-2,2,2-trifluoroethyl] 4-(4-heptylcyclohexyl)benzoate (PubChem CID 88516577) has the molecular formula C36H39F3O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is [(1S)-1-anthracen-9-yl-2,2,2-trifluoroethyl] 4-(4-heptylcyclohexyl)benzoate.
| Compound Name | [(1S)-1-anthracen-9-yl-2,2,2-trifluoroethyl] 4-(4-heptylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 88516577 |
| Molecular Formula | C36H39F3O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(1S)-1-anthracen-9-yl-2,2,2-trifluoroethyl] 4-(4-heptylcyclohexyl)benzoate |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)O[C@@H](c3c4ccccc4cc4ccccc34)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C36H39F3O2/c1-2-3-4-5-6-11-25-16-18-26(19-17-25)27-20-22-28(23-21-27)35(40)41-34(36(37,38)39)33-31-14-9-7-12-29(31)24-30-13-8-10-15-32(30)33/h7-10,12-15,20-26,34H,2-6,11,16-19H2,1H3/t25?,26?,34-/m0/s1 |
| InChIKey | PPOIYLOVKFWNMN-BVYPBUKXSA-N |
| XLogP | 11.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|