About 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine
3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine (PubChem CID 88516613) has the molecular formula C10H23N2O2P
and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine |
| PubChem CID | 88516613 |
| Molecular Formula | C10H23N2O2P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.N#CCCOCOP |
| InChI | InChI=1S/C6H15N.C4H8NO2P/c1-5(2)7-6(3)4;5-2-1-3-6-4-7-8/h5-7H,1-4H3;1,3-4,8H2 |
| InChIKey | LZAWGKSTRXCKOE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine?
The IUPAC name of 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine (CID 88516613) is 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine?
The canonical SMILES for 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.N#CCCOCOP.
What is the InChIKey of 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine?
The InChIKey is LZAWGKSTRXCKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H8NO2P/c1-5(2)7-6(3)4;5-2-1-3-6-4-7-8/h5-7H,1-4H3;1,3-4,8H2.
What are the key properties of 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine?
3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine has a molecular weight of 234.28 g/mol, XLogP of 2.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(phosphanyloxymethoxy)propanenitrile;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 88516613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).