About 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne
1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne (PubChem CID 88516759) has the molecular formula C16H30OSi
and a molecular weight of 266.50 g/mol. Its IUPAC name is 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne.
Molecular Properties
| Compound Name | 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne |
| PubChem CID | 88516759 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne |
| SMILES | C#CCC.CC(C)(C)[Si](C)(C)OC12CCCC1C2 |
| InChI | InChI=1S/C12H24OSi.C4H6/c1-11(2,3)14(4,5)13-12-8-6-7-10(12)9-12;1-3-4-2/h10H,6-9H2,1-5H3;1H,4H2,2H3 |
| InChIKey | RYXVFYIEMZIZIT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne?
The IUPAC name of 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne (CID 88516759) is 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne.
What is the SMILES notation for 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne?
The canonical SMILES for 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne is C#CCC.CC(C)(C)[Si](C)(C)OC12CCCC1C2.
What is the InChIKey of 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne?
The InChIKey is RYXVFYIEMZIZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi.C4H6/c1-11(2,3)14(4,5)13-12-8-6-7-10(12)9-12;1-3-4-2/h10H,6-9H2,1-5H3;1H,4H2,2H3.
What are the key properties of 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne?
1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne has a molecular weight of 266.50 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[3.1.0]hexanyloxy-tert-butyl-dimethylsilane;but-1-yne is sourced from PubChem (CID 88516759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).