About sodium;hydride;tris(1-methoxyethoxy)alumane
sodium;hydride;tris(1-methoxyethoxy)alumane (PubChem CID 88516794) has the molecular formula C9H22AlNaO6
and a molecular weight of 276.24 g/mol. Its IUPAC name is sodium;hydride;tris(1-methoxyethoxy)alumane.
Molecular Properties
| Compound Name | sodium;hydride;tris(1-methoxyethoxy)alumane |
| PubChem CID | 88516794 |
| Molecular Formula | C9H22AlNaO6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | sodium;hydride;tris(1-methoxyethoxy)alumane |
| SMILES | COC(C)O[Al](OC(C)OC)OC(C)OC.[H-].[Na+] |
| InChI | InChI=1S/3C3H7O2.Al.Na.H/c3*1-3(4)5-2;;;/h3*3H,1-2H3;;;/q3*-1;+3;+1;-1 |
| InChIKey | MNMNDUVBJPULCU-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;tris(1-methoxyethoxy)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;tris(1-methoxyethoxy)alumane?
The IUPAC name of sodium;hydride;tris(1-methoxyethoxy)alumane (CID 88516794) is sodium;hydride;tris(1-methoxyethoxy)alumane.
What is the SMILES notation for sodium;hydride;tris(1-methoxyethoxy)alumane?
The canonical SMILES for sodium;hydride;tris(1-methoxyethoxy)alumane is COC(C)O[Al](OC(C)OC)OC(C)OC.[H-].[Na+].
What is the InChIKey of sodium;hydride;tris(1-methoxyethoxy)alumane?
The InChIKey is MNMNDUVBJPULCU-UHFFFAOYSA-N. The full InChI is InChI=1S/3C3H7O2.Al.Na.H/c3*1-3(4)5-2;;;/h3*3H,1-2H3;;;/q3*-1;+3;+1;-1.
What are the key properties of sodium;hydride;tris(1-methoxyethoxy)alumane?
sodium;hydride;tris(1-methoxyethoxy)alumane has a molecular weight of 276.24 g/mol, XLogP of -1.89, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;tris(1-methoxyethoxy)alumane is sourced from PubChem (CID 88516794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).