C13H14N2O — CID 88516885
3,5,6,7,8-pentamethylidene-1,4,4a,8a-tetrahydroquinoxalin-2-one (PubChem CID 88516885) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 3,5,6,7,8-pentamethylidene-1,4,4a,8a-tetrahydroquinoxalin-2-one.
| Compound Name | 3,5,6,7,8-pentamethylidene-1,4,4a,8a-tetrahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 88516885 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3,5,6,7,8-pentamethylidene-1,4,4a,8a-tetrahydroquinoxalin-2-one |
| SMILES | C=C1NC2C(=C)C(=C)C(=C)C(=C)C2NC1=O |
| InChI | InChI=1S/C13H14N2O/c1-6-7(2)9(4)12-11(8(6)3)14-10(5)13(16)15-12/h11-12,14H,1-5H2,(H,15,16) |
| InChIKey | XYSWEELMMQQCQQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|