4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid

C10H20N2O6 — CID 88516953

IUPAC4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid
SMILESCC(C)(N)CCC(=O)NCCO.O=C(O)C(=O)O
InChIInChI=1S/C8H18N2O2.C2H2O4/c1-8(2,9)4-3-7(12)10-5-6-11;3-1(4)2(5)6/h11H,3-6,9H2,1-2H3,(H,10,12);(H,3,4)(H,5,6)
InChIKeyOBNHLWSALKSTEH-UHFFFAOYSA-N
MW264.28 g/mol
LogP-1.23
Rot. Bonds5

About 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid

4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid (PubChem CID 88516953) has the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid.

Molecular Properties

Compound Name4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid
PubChem CID88516953
Molecular FormulaC10H20N2O6
Molecular Weight264.28 g/mol
Exact Mass264.13
IUPAC Name4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid
SMILESCC(C)(N)CCC(=O)NCCO.O=C(O)C(=O)O
InChIInChI=1S/C8H18N2O2.C2H2O4/c1-8(2,9)4-3-7(12)10-5-6-11;3-1(4)2(5)6/h11H,3-6,9H2,1-2H3,(H,10,12);(H,3,4)(H,5,6)
InChIKeyOBNHLWSALKSTEH-UHFFFAOYSA-N
XLogP-1.23
TPSA149.95 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 5-1.23
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid?
The IUPAC name of 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid (CID 88516953) is 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid.
What is the SMILES notation for 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid?
The canonical SMILES for 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid is CC(C)(N)CCC(=O)NCCO.O=C(O)C(=O)O.
What is the InChIKey of 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid?
The InChIKey is OBNHLWSALKSTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2.C2H2O4/c1-8(2,9)4-3-7(12)10-5-6-11;3-1(4)2(5)6/h11H,3-6,9H2,1-2H3,(H,10,12);(H,3,4)(H,5,6).
What are the key properties of 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid?
4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid has a molecular weight of 264.28 g/mol, XLogP of -1.23, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid is sourced from PubChem (CID 88516953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).