C10H20N2O6 — CID 88516953
4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid (PubChem CID 88516953) has the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid.
| Compound Name | 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid |
|---|---|
| PubChem CID | 88516953 |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-amino-N-(2-hydroxyethyl)-4-methylpentanamide;oxalic acid |
| SMILES | CC(C)(N)CCC(=O)NCCO.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H18N2O2.C2H2O4/c1-8(2,9)4-3-7(12)10-5-6-11;3-1(4)2(5)6/h11H,3-6,9H2,1-2H3,(H,10,12);(H,3,4)(H,5,6) |
| InChIKey | OBNHLWSALKSTEH-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|