C47H53Cl4NO10 — CID 88517738
bis[(1S,3S)-3-[[(2S)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]cyclopentanecarbonyl] (2S)-2-aminopentanedioate (PubChem CID 88517738) has the molecular formula C47H53Cl4NO10 and a molecular weight of 933.75 g/mol. Its IUPAC name is bis[(1S,3S)-3-[[(2S)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]cyclopentanecarbonyl] (2S)-2-aminopentanedioate.
| Compound Name | bis[(1S,3S)-3-[[(2S)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]cyclopentanecarbonyl] (2S)-2-aminopentanedioate |
|---|---|
| PubChem CID | 88517738 |
| Molecular Formula | C47H53Cl4NO10 |
| Molecular Weight | 933.75 g/mol |
| Exact Mass | 931.24 |
| IUPAC Name | bis[(1S,3S)-3-[[(2S)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]cyclopentanecarbonyl] (2S)-2-aminopentanedioate |
| SMILES | C[C@@]1(C2CCCC2)Cc2cc(O[C@H]3CC[C@H](C(=O)OC(=O)CC[C@H](N)C(=O)OC(=O)[C@H]4CC[C@H](Oc5cc6c(c(Cl)c5Cl)C(=O)[C@](C)(C5CCCC5)C6)C4)C3)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C47H53Cl4NO10/c1-46(27-7-3-4-8-27)21-25-19-32(37(48)39(50)35(25)41(46)54)59-29-13-11-23(17-29)43(56)61-34(53)16-15-31(52)45(58)62-44(57)24-12-14-30(18-24)60-33-20-26-22-47(2,28-9-5-6-10-28)42(55)36(26)40(51)38(33)49/h19-20,23-24,27-31H,3-18,21-22,52H2,1-2H3/t23-,24-,29-,30-,31-,46-,47-/m0/s1 |
| InChIKey | BFGBYMUIFBWJOY-WCUKHLOLSA-N |
| XLogP | 10.21 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.75 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|