About N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine
N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine (PubChem CID 88517859) has the molecular formula C20H24N4
and a molecular weight of 320.44 g/mol. Its IUPAC name is N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine |
| PubChem CID | 88517859 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cccc1N.c1ccc(NCNc2ccccc2)cc1 |
| InChI | InChI=1S/C13H14N2.C7H10N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-5-6(8)3-2-4-7(5)9/h1-10,14-15H,11H2;2-4H,8-9H2,1H3 |
| InChIKey | WBWMVPTZJCXTFX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine?
The IUPAC name of N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine (CID 88517859) is N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine.
What is the SMILES notation for N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine?
The canonical SMILES for N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine is Cc1c(N)cccc1N.c1ccc(NCNc2ccccc2)cc1.
What is the InChIKey of N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine?
The InChIKey is WBWMVPTZJCXTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.C7H10N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-5-6(8)3-2-4-7(5)9/h1-10,14-15H,11H2;2-4H,8-9H2,1H3.
What are the key properties of N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine?
N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine has a molecular weight of 320.44 g/mol, XLogP of 4.33, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diphenylmethanediamine;2-methylbenzene-1,3-diamine is sourced from PubChem (CID 88517859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).