C18H22FNO2 — CID 88518265
(4R,5S)-4-[(4-fluorophenyl)methyl]-5-(1-hydroxybut-3-ynyl)-4-propan-2-ylpyrrolidin-2-one (PubChem CID 88518265) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is (4R,5S)-4-[(4-fluorophenyl)methyl]-5-(1-hydroxybut-3-ynyl)-4-propan-2-ylpyrrolidin-2-one.
| Compound Name | (4R,5S)-4-[(4-fluorophenyl)methyl]-5-(1-hydroxybut-3-ynyl)-4-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 88518265 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (4R,5S)-4-[(4-fluorophenyl)methyl]-5-(1-hydroxybut-3-ynyl)-4-propan-2-ylpyrrolidin-2-one |
| SMILES | C#CCC(O)[C@H]1NC(=O)C[C@]1(Cc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C18H22FNO2/c1-4-5-15(21)17-18(12(2)3,11-16(22)20-17)10-13-6-8-14(19)9-7-13/h1,6-9,12,15,17,21H,5,10-11H2,2-3H3,(H,20,22)/t15?,17-,18-/m1/s1 |
| InChIKey | SNDDFDKVVPQBKR-HSFDIDPMSA-N |
| XLogP | 2.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|