About 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride
1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride (PubChem CID 88518629) has the molecular formula C12H19ClN4OS
and a molecular weight of 302.83 g/mol. Its IUPAC name is 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride.
Molecular Properties
| Compound Name | 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride |
| PubChem CID | 88518629 |
| Molecular Formula | C12H19ClN4OS |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride |
| SMILES | CN1C=C[NH+](C)C1CC(=O)CSc1nccn1C.[Cl-] |
| InChI | InChI=1S/C12H18N4OS.ClH/c1-14-6-7-15(2)11(14)8-10(17)9-18-12-13-4-5-16(12)3;/h4-7,11H,8-9H2,1-3H3;1H |
| InChIKey | ARWHADMJGZPJKW-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride?
The IUPAC name of 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride (CID 88518629) is 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride.
What is the SMILES notation for 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride?
The canonical SMILES for 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride is CN1C=C[NH+](C)C1CC(=O)CSc1nccn1C.[Cl-].
What is the InChIKey of 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride?
The InChIKey is ARWHADMJGZPJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS.ClH/c1-14-6-7-15(2)11(14)8-10(17)9-18-12-13-4-5-16(12)3;/h4-7,11H,8-9H2,1-3H3;1H.
What are the key properties of 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride?
1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride has a molecular weight of 302.83 g/mol, XLogP of -3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one chloride is sourced from PubChem (CID 88518629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).