About 2-butyl-3-undecyloxirane
2-butyl-3-undecyloxirane (PubChem CID 88518775) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-butyl-3-undecyloxirane.
Molecular Properties
| Compound Name | 2-butyl-3-undecyloxirane |
| PubChem CID | 88518775 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 2-butyl-3-undecyloxirane |
| SMILES | CCCCCCCCCCCC1OC1CCCC |
| InChI | InChI=1S/C17H34O/c1-3-5-7-8-9-10-11-12-13-15-17-16(18-17)14-6-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | ZWIQMQSITAYIAE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-3-undecyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-undecyloxirane?
The IUPAC name of 2-butyl-3-undecyloxirane (CID 88518775) is 2-butyl-3-undecyloxirane.
What is the SMILES notation for 2-butyl-3-undecyloxirane?
The canonical SMILES for 2-butyl-3-undecyloxirane is CCCCCCCCCCCC1OC1CCCC.
What is the InChIKey of 2-butyl-3-undecyloxirane?
The InChIKey is ZWIQMQSITAYIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-3-5-7-8-9-10-11-12-13-15-17-16(18-17)14-6-4-2/h16-17H,3-15H2,1-2H3.
What are the key properties of 2-butyl-3-undecyloxirane?
2-butyl-3-undecyloxirane has a molecular weight of 254.46 g/mol, XLogP of 5.86, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-undecyloxirane is sourced from PubChem (CID 88518775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).