About 2-chloro-3,5,6-triethylpyrazine
2-chloro-3,5,6-triethylpyrazine (PubChem CID 88518877) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 2-chloro-3,5,6-triethylpyrazine.
Molecular Properties
| Compound Name | 2-chloro-3,5,6-triethylpyrazine |
| PubChem CID | 88518877 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-chloro-3,5,6-triethylpyrazine |
| SMILES | CCc1nc(CC)c(CC)nc1Cl |
| InChI | InChI=1S/C10H15ClN2/c1-4-7-8(5-2)13-10(11)9(6-3)12-7/h4-6H2,1-3H3 |
| InChIKey | QJYWXMLDDAHXMI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-3,5,6-triethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,5,6-triethylpyrazine?
The IUPAC name of 2-chloro-3,5,6-triethylpyrazine (CID 88518877) is 2-chloro-3,5,6-triethylpyrazine.
What is the SMILES notation for 2-chloro-3,5,6-triethylpyrazine?
The canonical SMILES for 2-chloro-3,5,6-triethylpyrazine is CCc1nc(CC)c(CC)nc1Cl.
What is the InChIKey of 2-chloro-3,5,6-triethylpyrazine?
The InChIKey is QJYWXMLDDAHXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2/c1-4-7-8(5-2)13-10(11)9(6-3)12-7/h4-6H2,1-3H3.
What are the key properties of 2-chloro-3,5,6-triethylpyrazine?
2-chloro-3,5,6-triethylpyrazine has a molecular weight of 198.70 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,5,6-triethylpyrazine is sourced from PubChem (CID 88518877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).