About cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate
cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate (PubChem CID 88519754) has the molecular formula C16H18FeO3-6
and a molecular weight of 314.16 g/mol. Its IUPAC name is cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate.
Molecular Properties
| Compound Name | cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate |
| PubChem CID | 88519754 |
| Molecular Formula | C16H18FeO3-6 |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate |
| SMILES | CCC(=O)OC(=O)C(C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C11H13O3.C5H5.Fe/c1-3-10(12)14-11(13)8(2)9-6-4-5-7-9;1-2-4-5-3-1;/h4-8H,3H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | GQSPWPIMYJUGSN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate?
The IUPAC name of cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate (CID 88519754) is cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate.
What is the SMILES notation for cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate?
The canonical SMILES for cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate is CCC(=O)OC(=O)C(C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate?
The InChIKey is GQSPWPIMYJUGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O3.C5H5.Fe/c1-3-10(12)14-11(13)8(2)9-6-4-5-7-9;1-2-4-5-3-1;/h4-8H,3H2,1-2H3;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate?
cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate has a molecular weight of 314.16 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;iron;propanoyl 2-cyclopenta-2,4-dien-1-ylpropanoate is sourced from PubChem (CID 88519754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).