About [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride
[3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride (PubChem CID 88519807) has the molecular formula C13H30Cl2N4O4
and a molecular weight of 377.31 g/mol. Its IUPAC name is [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride.
Molecular Properties
| Compound Name | [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride |
| PubChem CID | 88519807 |
| Molecular Formula | C13H30Cl2N4O4 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride |
| SMILES | CCNC(=O)OC(C)C(N)(CCN)C(C)OC(=O)NCC.Cl.Cl |
| InChI | InChI=1S/C13H28N4O4.2ClH/c1-5-16-11(18)20-9(3)13(15,7-8-14)10(4)21-12(19)17-6-2;;/h9-10H,5-8,14-15H2,1-4H3,(H,16,18)(H,17,19);2*1H |
| InChIKey | PRXBBFCPVDHVNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The IUPAC name of [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride (CID 88519807) is [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride.
What is the SMILES notation for [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The canonical SMILES for [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride is CCNC(=O)OC(C)C(N)(CCN)C(C)OC(=O)NCC.Cl.Cl.
What is the InChIKey of [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The InChIKey is PRXBBFCPVDHVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4O4.2ClH/c1-5-16-11(18)20-9(3)13(15,7-8-14)10(4)21-12(19)17-6-2;;/h9-10H,5-8,14-15H2,1-4H3,(H,16,18)(H,17,19);2*1H.
What are the key properties of [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
[3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride has a molecular weight of 377.31 g/mol, XLogP of 1.15, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-3-(2-aminoethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride is sourced from PubChem (CID 88519807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).