About [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride
[3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride (PubChem CID 88519817) has the molecular formula C12H28Cl2N4O4
and a molecular weight of 363.29 g/mol. Its IUPAC name is [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride.
Molecular Properties
| Compound Name | [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride |
| PubChem CID | 88519817 |
| Molecular Formula | C12H28Cl2N4O4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride |
| SMILES | CCNC(=O)OC(C)C(N)(CN)C(C)OC(=O)NCC.Cl.Cl |
| InChI | InChI=1S/C12H26N4O4.2ClH/c1-5-15-10(17)19-8(3)12(14,7-13)9(4)20-11(18)16-6-2;;/h8-9H,5-7,13-14H2,1-4H3,(H,15,17)(H,16,18);2*1H |
| InChIKey | ZFXAEOYBKKELON-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The IUPAC name of [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride (CID 88519817) is [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride.
What is the SMILES notation for [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The canonical SMILES for [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride is CCNC(=O)OC(C)C(N)(CN)C(C)OC(=O)NCC.Cl.Cl.
What is the InChIKey of [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
The InChIKey is ZFXAEOYBKKELON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O4.2ClH/c1-5-15-10(17)19-8(3)12(14,7-13)9(4)20-11(18)16-6-2;;/h8-9H,5-7,13-14H2,1-4H3,(H,15,17)(H,16,18);2*1H.
What are the key properties of [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride?
[3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride has a molecular weight of 363.29 g/mol, XLogP of 0.76, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-3-(aminomethyl)-4-(ethylcarbamoyloxy)pentan-2-yl] N-ethylcarbamate;dihydrochloride is sourced from PubChem (CID 88519817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).