About 3,3-dichlorocyclohexyne
3,3-dichlorocyclohexyne (PubChem CID 88520352) has the molecular formula C6H6Cl2
and a molecular weight of 149.02 g/mol. Its IUPAC name is 3,3-dichlorocyclohexyne.
Molecular Properties
| Compound Name | 3,3-dichlorocyclohexyne |
| PubChem CID | 88520352 |
| Molecular Formula | C6H6Cl2 |
| Molecular Weight | 149.02 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | 3,3-dichlorocyclohexyne |
| SMILES | ClC1(Cl)C#CCCC1 |
| InChI | InChI=1S/C6H6Cl2/c7-6(8)4-2-1-3-5-6/h1-2,4H2 |
| InChIKey | GRPPXGCICUHAPP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.02 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dichlorocyclohexyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dichlorocyclohexyne?
The IUPAC name of 3,3-dichlorocyclohexyne (CID 88520352) is 3,3-dichlorocyclohexyne.
What is the SMILES notation for 3,3-dichlorocyclohexyne?
The canonical SMILES for 3,3-dichlorocyclohexyne is ClC1(Cl)C#CCCC1.
What is the InChIKey of 3,3-dichlorocyclohexyne?
The InChIKey is GRPPXGCICUHAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2/c7-6(8)4-2-1-3-5-6/h1-2,4H2.
What are the key properties of 3,3-dichlorocyclohexyne?
3,3-dichlorocyclohexyne has a molecular weight of 149.02 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dichlorocyclohexyne is sourced from PubChem (CID 88520352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).