C12H6N12O9S4 — CID 88520484
3-[2,3-bis(azidosulfonyl)phenoxy]-1-N,2-N-didiazobenzene-1,2-disulfonamide (PubChem CID 88520484) has the molecular formula C12H6N12O9S4 and a molecular weight of 590.52 g/mol. Its IUPAC name is 3-[2,3-bis(azidosulfonyl)phenoxy]-1-N,2-N-didiazobenzene-1,2-disulfonamide.
| Compound Name | 3-[2,3-bis(azidosulfonyl)phenoxy]-1-N,2-N-didiazobenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 88520484 |
| Molecular Formula | C12H6N12O9S4 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 589.93 |
| IUPAC Name | 3-[2,3-bis(azidosulfonyl)phenoxy]-1-N,2-N-didiazobenzene-1,2-disulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1cccc(Oc2cccc(S(=O)(=O)N=[N+]=[N-])c2S(=O)(=O)N=[N+]=[N-])c1S(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C12H6N12O9S4/c13-17-21-34(25,26)9-5-1-3-7(11(9)36(29,30)23-19-15)33-8-4-2-6-10(35(27,28)22-18-14)12(8)37(31,32)24-20-16/h1-6H |
| InChIKey | PSQBUBRICAUYFO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 340.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|