C14H4F12N2O2 — CID 88520894
[2-[4-(2-cyanato-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] cyanate (PubChem CID 88520894) has the molecular formula C14H4F12N2O2 and a molecular weight of 460.17 g/mol. Its IUPAC name is [2-[4-(2-cyanato-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] cyanate.
| Compound Name | [2-[4-(2-cyanato-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] cyanate |
|---|---|
| PubChem CID | 88520894 |
| Molecular Formula | C14H4F12N2O2 |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | [2-[4-(2-cyanato-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] cyanate |
| SMILES | N#COC(c1ccc(C(OC#N)(C(F)(F)F)C(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H4F12N2O2/c15-11(16,17)9(29-5-27,12(18,19)20)7-1-2-8(4-3-7)10(30-6-28,13(21,22)23)14(24,25)26/h1-4H |
| InChIKey | JFKQSGQEPTXUBP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|