C13H15N — CID 88521331
1,2,3,4,4a,5-hexahydrobenzo[f]quinoline (PubChem CID 88521331) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrobenzo[f]quinoline.
| Compound Name | 1,2,3,4,4a,5-hexahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 88521331 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrobenzo[f]quinoline |
| SMILES | C1=c2ccccc2=C2CCCNC2C1 |
| InChI | InChI=1S/C13H15N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-2,4-5,7,13-14H,3,6,8-9H2 |
| InChIKey | QWGHFZMAIFWKFO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |