C46H44Br4N2O2 — CID 88521463
4,5,6,7-tetrabromo-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-methylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 88521463) has the molecular formula C46H44Br4N2O2 and a molecular weight of 976.49 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-methylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrabromo-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-methylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 88521463 |
| Molecular Formula | C46H44Br4N2O2 |
| Molecular Weight | 976.49 g/mol |
| Exact Mass | 972.01 |
| IUPAC Name | 4,5,6,7-tetrabromo-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-methylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | CCN(CC)c1ccc(/C(=C/C2(/C=C(\c3ccc(C)cc3)c3ccc(N(CC)CC)cc3)OC(=O)c3c(Br)c(Br)c(Br)c(Br)c32)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C46H44Br4N2O2/c1-7-51(8-2)35-23-19-33(20-24-35)37(31-15-11-29(5)12-16-31)27-46(40-39(45(53)54-46)41(47)43(49)44(50)42(40)48)28-38(32-17-13-30(6)14-18-32)34-21-25-36(26-22-34)52(9-3)10-4/h11-28H,7-10H2,1-6H3/b37-27+,38-28+ |
| InChIKey | LKSGFTWKYYFCEU-RIGUPBQNSA-N |
| XLogP | 13.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.49 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|