C30H43N4O7P — CID 88521519
[(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino] dihydrogen phosphate;2-[(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino]oxyacetic acid (PubChem CID 88521519) has the molecular formula C30H43N4O7P and a molecular weight of 602.67 g/mol. Its IUPAC name is [(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino] dihydrogen phosphate;2-[(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino]oxyacetic acid.
| Compound Name | [(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino] dihydrogen phosphate;2-[(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino]oxyacetic acid |
|---|---|
| PubChem CID | 88521519 |
| Molecular Formula | C30H43N4O7P |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino] dihydrogen phosphate;2-[(1-pentyl-2,3-dihydroquinolin-4-ylidene)amino]oxyacetic acid |
| SMILES | CCCCCN1CCC(=NOCC(=O)O)c2ccccc21.CCCCCN1CCC(=NOP(=O)(O)O)c2ccccc21 |
| InChI | InChI=1S/C16H22N2O3.C14H21N2O4P/c1-2-3-6-10-18-11-9-14(17-21-12-16(19)20)13-7-4-5-8-15(13)18;1-2-3-6-10-16-11-9-13(15-20-21(17,18)19)12-7-4-5-8-14(12)16/h4-5,7-8H,2-3,6,9-12H2,1H3,(H,19,20);4-5,7-8H,2-3,6,9-11H2,1H3,(H2,17,18,19) |
| InChIKey | ZJGHYQGWILBOBK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|