C19H18Cl3F3O2 — CID 88521546
cis-[3-(2,2-dichloroethenyl)-2-methylphenyl]methyl (1R,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88521546) has the molecular formula C19H18Cl3F3O2 and a molecular weight of 441.70 g/mol. Its IUPAC name is cis-[3-(2,2-dichloroethenyl)-2-methylphenyl]methyl (1R,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[3-(2,2-dichloroethenyl)-2-methylphenyl]methyl (1R,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88521546 |
| Molecular Formula | C19H18Cl3F3O2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | cis-[3-(2,2-dichloroethenyl)-2-methylphenyl]methyl (1R,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1c(C=C(Cl)Cl)cccc1COC(=O)[C@@H]1[C@@H](C=C(Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C19H18Cl3F3O2/c1-10-11(7-15(21)22)5-4-6-12(10)9-27-17(26)16-13(18(16,2)3)8-14(20)19(23,24)25/h4-8,13,16H,9H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | QVZOGTILZHHKHY-CJNGLKHVSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |