C11H13N3OS — CID 88522570
7-ethyl-2-sulfanyl-2,3,5,7-tetrahydro-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 88522570) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 7-ethyl-2-sulfanyl-2,3,5,7-tetrahydro-1H-pyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 7-ethyl-2-sulfanyl-2,3,5,7-tetrahydro-1H-pyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 88522570 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 7-ethyl-2-sulfanyl-2,3,5,7-tetrahydro-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCC1C(=O)Nc2cc3c(cc21)NC(S)N3 |
| InChI | InChI=1S/C11H13N3OS/c1-2-5-6-3-8-9(14-11(16)13-8)4-7(6)12-10(5)15/h3-5,11,13-14,16H,2H2,1H3,(H,12,15) |
| InChIKey | BKFANIQMGTZUQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|