C32H60N2O8 — CID 88522677
[2,5-dimethyl-5-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetyl]peroxyhexan-2-yl] 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethaneperoxoate (PubChem CID 88522677) has the molecular formula C32H60N2O8 and a molecular weight of 600.84 g/mol. Its IUPAC name is [2,5-dimethyl-5-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetyl]peroxyhexan-2-yl] 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethaneperoxoate.
| Compound Name | [2,5-dimethyl-5-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetyl]peroxyhexan-2-yl] 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethaneperoxoate |
|---|---|
| PubChem CID | 88522677 |
| Molecular Formula | C32H60N2O8 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.43 |
| IUPAC Name | [2,5-dimethyl-5-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetyl]peroxyhexan-2-yl] 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethaneperoxoate |
| SMILES | CN1C(C)(C)CC(OCC(=O)OOC(C)(C)CCC(C)(C)OOC(=O)COC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C32H60N2O8/c1-27(2)17-23(18-28(3,4)33(27)13)37-21-25(35)39-41-31(9,10)15-16-32(11,12)42-40-26(36)22-38-24-19-29(5,6)34(14)30(7,8)20-24/h23-24H,15-22H2,1-14H3 |
| InChIKey | WJOIXQNARNDINX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|