About 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid
1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid (PubChem CID 88522934) has the molecular formula C13H14O5S2
and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid.
Molecular Properties
| Compound Name | 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid |
| PubChem CID | 88522934 |
| Molecular Formula | C13H14O5S2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid |
| SMILES | Cc1ccccc1S(=O)(=O)OC1(S(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C13H14O5S2/c1-11-7-3-4-8-12(11)20(16,17)18-13(19(14)15)9-5-2-6-10-13/h2-9H,10H2,1H3,(H,14,15) |
| InChIKey | WKXNOEOHHQGGTA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid?
The IUPAC name of 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid (CID 88522934) is 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid.
What is the SMILES notation for 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid?
The canonical SMILES for 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid is Cc1ccccc1S(=O)(=O)OC1(S(=O)O)C=CC=CC1.
What is the InChIKey of 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid?
The InChIKey is WKXNOEOHHQGGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5S2/c1-11-7-3-4-8-12(11)20(16,17)18-13(19(14)15)9-5-2-6-10-13/h2-9H,10H2,1H3,(H,14,15).
What are the key properties of 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid?
1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid has a molecular weight of 314.38 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfinic acid is sourced from PubChem (CID 88522934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).