C35H32IN2O5PS — CID 88522965
[(6R)-7-formamido-2-[(4-methoxyphenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium iodide (PubChem CID 88522965) has the molecular formula C35H32IN2O5PS and a molecular weight of 750.60 g/mol. Its IUPAC name is [(6R)-7-formamido-2-[(4-methoxyphenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium iodide.
| Compound Name | [(6R)-7-formamido-2-[(4-methoxyphenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 88522965 |
| Molecular Formula | C35H32IN2O5PS |
| Molecular Weight | 750.60 g/mol |
| Exact Mass | 750.08 |
| IUPAC Name | [(6R)-7-formamido-2-[(4-methoxyphenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium iodide |
| SMILES | COc1ccc(COC(=O)C2=C(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)CS[C@@H]3C(NC=O)C(=O)N23)cc1.[I-] |
| InChI | InChI=1S/C35H31N2O5PS.HI/c1-41-27-19-17-25(18-20-27)21-42-35(40)32-26(23-44-34-31(36-24-38)33(39)37(32)34)22-43(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30;/h2-20,24,31,34H,21-23H2,1H3;1H/t31?,34-;/m1./s1 |
| InChIKey | XZUWZYKCZYNPQI-BSSZNEBISA-N |
| XLogP | 1.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.60 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|