About 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde
6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde (PubChem CID 88523382) has the molecular formula C17H14O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde |
| PubChem CID | 88523382 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde |
| SMILES | COc1cccc2c1Oc1ccc(C=O)cc1C(=O)CC2 |
| InChI | InChI=1S/C17H14O4/c1-20-16-4-2-3-12-6-7-14(19)13-9-11(10-18)5-8-15(13)21-17(12)16/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | TVYRUSNOTACOLC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde?
The IUPAC name of 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde (CID 88523382) is 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde.
What is the SMILES notation for 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde?
The canonical SMILES for 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde is COc1cccc2c1Oc1ccc(C=O)cc1C(=O)CC2.
What is the InChIKey of 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde?
The InChIKey is TVYRUSNOTACOLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O4/c1-20-16-4-2-3-12-6-7-14(19)13-9-11(10-18)5-8-15(13)21-17(12)16/h2-5,8-10H,6-7H2,1H3.
What are the key properties of 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde?
6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde has a molecular weight of 282.30 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-12-oxo-10,11-dihydrobenzo[b][1]benzoxocine-2-carbaldehyde is sourced from PubChem (CID 88523382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).