C22H30Cl2OZr — CID 88523648
1-chloro-1-[2-(1-chloro-4,5,6,7-tetrahydroinden-1-yl)ethyl]-4,5,6,7-tetrahydroindene;ethanol;zirconium (PubChem CID 88523648) has the molecular formula C22H30Cl2OZr and a molecular weight of 472.61 g/mol. Its IUPAC name is 1-chloro-1-[2-(1-chloro-4,5,6,7-tetrahydroinden-1-yl)ethyl]-4,5,6,7-tetrahydroindene;ethanol;zirconium.
| Compound Name | 1-chloro-1-[2-(1-chloro-4,5,6,7-tetrahydroinden-1-yl)ethyl]-4,5,6,7-tetrahydroindene;ethanol;zirconium |
|---|---|
| PubChem CID | 88523648 |
| Molecular Formula | C22H30Cl2OZr |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1-chloro-1-[2-(1-chloro-4,5,6,7-tetrahydroinden-1-yl)ethyl]-4,5,6,7-tetrahydroindene;ethanol;zirconium |
| SMILES | CCO.ClC1(CCC2(Cl)C=CC3=C2CCCC3)C=CC2=C1CCCC2.[Zr] |
| InChI | InChI=1S/C20H24Cl2.C2H6O.Zr/c21-19(11-9-15-5-1-3-7-17(15)19)13-14-20(22)12-10-16-6-2-4-8-18(16)20;1-2-3;/h9-12H,1-8,13-14H2;3H,2H2,1H3; |
| InChIKey | QXORVXVDGZWGOA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|