About N'-(2,4,4-trimethylpentan-2-yl)propanediamide
N'-(2,4,4-trimethylpentan-2-yl)propanediamide (PubChem CID 88523859) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-(2,4,4-trimethylpentan-2-yl)propanediamide.
Molecular Properties
| Compound Name | N'-(2,4,4-trimethylpentan-2-yl)propanediamide |
| PubChem CID | 88523859 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N'-(2,4,4-trimethylpentan-2-yl)propanediamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CC(N)=O |
| InChI | InChI=1S/C11H22N2O2/c1-10(2,3)7-11(4,5)13-9(15)6-8(12)14/h6-7H2,1-5H3,(H2,12,14)(H,13,15) |
| InChIKey | GJIWSLCAMFTMHL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,4,4-trimethylpentan-2-yl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,4,4-trimethylpentan-2-yl)propanediamide?
The IUPAC name of N'-(2,4,4-trimethylpentan-2-yl)propanediamide (CID 88523859) is N'-(2,4,4-trimethylpentan-2-yl)propanediamide.
What is the SMILES notation for N'-(2,4,4-trimethylpentan-2-yl)propanediamide?
The canonical SMILES for N'-(2,4,4-trimethylpentan-2-yl)propanediamide is CC(C)(C)CC(C)(C)NC(=O)CC(N)=O.
What is the InChIKey of N'-(2,4,4-trimethylpentan-2-yl)propanediamide?
The InChIKey is GJIWSLCAMFTMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-10(2,3)7-11(4,5)13-9(15)6-8(12)14/h6-7H2,1-5H3,(H2,12,14)(H,13,15).
What are the key properties of N'-(2,4,4-trimethylpentan-2-yl)propanediamide?
N'-(2,4,4-trimethylpentan-2-yl)propanediamide has a molecular weight of 214.31 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,4,4-trimethylpentan-2-yl)propanediamide is sourced from PubChem (CID 88523859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).