C11H16INO4 — CID 88524259
1-iodoprop-2-ynyl (2S)-2-(butoxycarbonylamino)propanoate (PubChem CID 88524259) has the molecular formula C11H16INO4 and a molecular weight of 353.16 g/mol. Its IUPAC name is 1-iodoprop-2-ynyl (2S)-2-(butoxycarbonylamino)propanoate.
| Compound Name | 1-iodoprop-2-ynyl (2S)-2-(butoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 88524259 |
| Molecular Formula | C11H16INO4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 1-iodoprop-2-ynyl (2S)-2-(butoxycarbonylamino)propanoate |
| SMILES | C#CC(I)OC(=O)[C@H](C)NC(=O)OCCCC |
| InChI | InChI=1S/C11H16INO4/c1-4-6-7-16-11(15)13-8(3)10(14)17-9(12)5-2/h2,8-9H,4,6-7H2,1,3H3,(H,13,15)/t8-,9?/m0/s1 |
| InChIKey | VJPYQBBMXYBWRT-IENPIDJESA-N |
| XLogP | 1.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|