C11H17ClOTi — CID 88524324
chlorotitanium(1+);ethanol;4,5,6,7-tetrahydro-1H-inden-1-ide (PubChem CID 88524324) has the molecular formula C11H17ClOTi and a molecular weight of 248.58 g/mol. Its IUPAC name is chlorotitanium(1+);ethanol;4,5,6,7-tetrahydro-1H-inden-1-ide.
| Compound Name | chlorotitanium(1+);ethanol;4,5,6,7-tetrahydro-1H-inden-1-ide |
|---|---|
| PubChem CID | 88524324 |
| Molecular Formula | C11H17ClOTi |
| Molecular Weight | 248.58 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | chlorotitanium(1+);ethanol;4,5,6,7-tetrahydro-1H-inden-1-ide |
| SMILES | CCO.Cl[Ti+].c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/C9H11.C2H6O.ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;1-2-3;;/h3,6-7H,1-2,4-5H2;3H,2H2,1H3;1H;/q-1;;;+2/p-1 |
| InChIKey | LUCCHMWPZYHDKS-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|