About 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate
2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate (PubChem CID 88524769) has the molecular formula C28H29NO4P2
and a molecular weight of 505.49 g/mol. Its IUPAC name is 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate.
Molecular Properties
| Compound Name | 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate |
| PubChem CID | 88524769 |
| Molecular Formula | C28H29NO4P2 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate |
| SMILES | O=P([O-])(OCCNCCc1ccccc1)O[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO4P2/c30-35(31,32-24-23-29-22-21-25-13-5-1-6-14-25)33-34(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29H,21-24H2 |
| InChIKey | DYZAPUKNHZCLGE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate?
The IUPAC name of 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate (CID 88524769) is 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate.
What is the SMILES notation for 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate?
The canonical SMILES for 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate is O=P([O-])(OCCNCCc1ccccc1)O[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate?
The InChIKey is DYZAPUKNHZCLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO4P2/c30-35(31,32-24-23-29-22-21-25-13-5-1-6-14-25)33-34(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29H,21-24H2.
What are the key properties of 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate?
2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate has a molecular weight of 505.49 g/mol, XLogP of 4.23, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethylamino)ethyl triphenylphosphaniumyl phosphate is sourced from PubChem (CID 88524769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).