C12H10BrF4NO — CID 88525554
(4-bromo-2,3,5,6-tetrafluorophenyl)-[2-(ethylamino)cyclopropyl]methanone (PubChem CID 88525554) has the molecular formula C12H10BrF4NO and a molecular weight of 340.11 g/mol. Its IUPAC name is (4-bromo-2,3,5,6-tetrafluorophenyl)-[2-(ethylamino)cyclopropyl]methanone.
| Compound Name | (4-bromo-2,3,5,6-tetrafluorophenyl)-[2-(ethylamino)cyclopropyl]methanone |
|---|---|
| PubChem CID | 88525554 |
| Molecular Formula | C12H10BrF4NO |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (4-bromo-2,3,5,6-tetrafluorophenyl)-[2-(ethylamino)cyclopropyl]methanone |
| SMILES | CCNC1CC1C(=O)c1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C12H10BrF4NO/c1-2-18-5-3-4(5)12(19)6-8(14)10(16)7(13)11(17)9(6)15/h4-5,18H,2-3H2,1H3 |
| InChIKey | JREVNZBXOJEUDE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|