About sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine
sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine (PubChem CID 88525558) has the molecular formula C18H15ClFN2NaO2S
and a molecular weight of 400.84 g/mol. Its IUPAC name is sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine |
| PubChem CID | 88525558 |
| Molecular Formula | C18H15ClFN2NaO2S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.Fc1ccccc1-c1ccccn1.[Na+] |
| InChI | InChI=1S/C11H8FN.C7H7ClNO2S.Na/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11;1-6-2-4-7(5-3-6)12(10,11)9-8;/h1-8H;2-5H,1H3;/q;-1;+1 |
| InChIKey | GITJQCUHVWXHAH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine?
The IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine (CID 88525558) is sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine.
What is the SMILES notation for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine?
The canonical SMILES for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine is Cc1ccc(S(=O)(=O)[N-]Cl)cc1.Fc1ccccc1-c1ccccn1.[Na+].
What is the InChIKey of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine?
The InChIKey is GITJQCUHVWXHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN.C7H7ClNO2S.Na/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11;1-6-2-4-7(5-3-6)12(10,11)9-8;/h1-8H;2-5H,1H3;/q;-1;+1.
What are the key properties of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine?
sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine has a molecular weight of 400.84 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(2-fluorophenyl)pyridine is sourced from PubChem (CID 88525558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).